C32H43FN4O3 — CID 168927264
1-N'-[4-[1-[4-but-3-enoxy-2-(ethylideneamino)-6-fluorophenyl]ethenylamino]phenyl]-1-N-(2,2-dimethylpropyl)cyclopropane-1,1-dicarboxamide;ethane (PubChem CID 168927264) has the molecular formula C32H43FN4O3 and a molecular weight of 550.72 g/mol. Its IUPAC name is 1-N'-[4-[1-[4-but-3-enoxy-2-(ethylideneamino)-6-fluorophenyl]ethenylamino]phenyl]-1-N-(2,2-dimethylpropyl)cyclopropane-1,1-dicarboxamide;ethane.
| Compound Name | 1-N'-[4-[1-[4-but-3-enoxy-2-(ethylideneamino)-6-fluorophenyl]ethenylamino]phenyl]-1-N-(2,2-dimethylpropyl)cyclopropane-1,1-dicarboxamide;ethane |
|---|---|
| PubChem CID | 168927264 |
| Molecular Formula | C32H43FN4O3 |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | 1-N'-[4-[1-[4-but-3-enoxy-2-(ethylideneamino)-6-fluorophenyl]ethenylamino]phenyl]-1-N-(2,2-dimethylpropyl)cyclopropane-1,1-dicarboxamide;ethane |
| SMILES | C=CCCOc1cc(F)c(C(=C)Nc2ccc(NC(=O)C3(C(=O)NCC(C)(C)C)CC3)cc2)c(/N=C/C)c1.CC |
| InChI | InChI=1S/C30H37FN4O3.C2H6/c1-7-9-16-38-23-17-24(31)26(25(18-23)32-8-2)20(3)34-21-10-12-22(13-11-21)35-28(37)30(14-15-30)27(36)33-19-29(4,5)6;1-2/h7-8,10-13,17-18,34H,1,3,9,14-16,19H2,2,4-6H3,(H,33,36)(H,35,37);1-2H3/b32-8+; |
| InChIKey | YXVOWZHLFNHXHQ-ZXHNHOBYSA-N |
| XLogP | 7.49 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|