C23H29FN4O3 — CID 168927219
N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(methylamino)propanamide (PubChem CID 168927219) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(methylamino)propanamide.
| Compound Name | N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 168927219 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-2-(methylamino)propanamide |
| SMILES | C=C(Nc1ccc(NC(=O)C(C)NC)cc1)c1c(F)cc(OCCOC)cc1/N=C/C |
| InChI | InChI=1S/C23H29FN4O3/c1-6-26-21-14-19(31-12-11-30-5)13-20(24)22(21)15(2)27-17-7-9-18(10-8-17)28-23(29)16(3)25-4/h6-10,13-14,16,25,27H,2,11-12H2,1,3-5H3,(H,28,29)/b26-6+ |
| InChIKey | OITJRWBCROPIEY-GOTRBWPWSA-N |
| XLogP | 4.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|