C30H42FN5O3 — CID 168927083
1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(4-methylpentoxy)phenyl]ethenylamino]phenyl]-3-[2-[methyl(4-oxobutyl)amino]ethyl]urea (PubChem CID 168927083) has the molecular formula C30H42FN5O3 and a molecular weight of 539.70 g/mol. Its IUPAC name is 1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(4-methylpentoxy)phenyl]ethenylamino]phenyl]-3-[2-[methyl(4-oxobutyl)amino]ethyl]urea.
| Compound Name | 1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(4-methylpentoxy)phenyl]ethenylamino]phenyl]-3-[2-[methyl(4-oxobutyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 168927083 |
| Molecular Formula | C30H42FN5O3 |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | 1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(4-methylpentoxy)phenyl]ethenylamino]phenyl]-3-[2-[methyl(4-oxobutyl)amino]ethyl]urea |
| SMILES | C=C(Nc1ccc(NC(=O)NCCN(C)CCCC=O)cc1)c1c(F)cc(OCCCC(C)C)cc1/N=C/C |
| InChI | InChI=1S/C30H42FN5O3/c1-6-32-28-21-26(39-19-9-10-22(2)3)20-27(31)29(28)23(4)34-24-11-13-25(14-12-24)35-30(38)33-15-17-36(5)16-7-8-18-37/h6,11-14,18,20-22,34H,4,7-10,15-17,19H2,1-3,5H3,(H2,33,35,38)/b32-6+ |
| InChIKey | QVHYGVKGRIVEBI-LNMUSBCZSA-N |
| XLogP | 6.48 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|