C26H35FN4O4 — CID 168927114
1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]urea (PubChem CID 168927114) has the molecular formula C26H35FN4O4 and a molecular weight of 486.59 g/mol. Its IUPAC name is 1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]urea.
| Compound Name | 1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]urea |
|---|---|
| PubChem CID | 168927114 |
| Molecular Formula | C26H35FN4O4 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenylamino]phenyl]-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]urea |
| SMILES | C=C(Nc1ccc(NC(=O)NCCOC(C)(C)C)cc1)c1c(F)cc(OCCOC)cc1/N=C/C |
| InChI | InChI=1S/C26H35FN4O4/c1-7-28-23-17-21(34-15-14-33-6)16-22(27)24(23)18(2)30-19-8-10-20(11-9-19)31-25(32)29-12-13-35-26(3,4)5/h7-11,16-17,30H,2,12-15H2,1,3-6H3,(H2,29,31,32)/b28-7+ |
| InChIKey | LUPRHPVTVMWJED-WBSLIQCRSA-N |
| XLogP | 5.59 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|