C24H30FN5O4 — CID 171419900
1-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-(3-methoxy-3-methylbutyl)urea (PubChem CID 171419900) has the molecular formula C24H30FN5O4 and a molecular weight of 471.53 g/mol. Its IUPAC name is 1-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-(3-methoxy-3-methylbutyl)urea.
| Compound Name | 1-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-(3-methoxy-3-methylbutyl)urea |
|---|---|
| PubChem CID | 171419900 |
| Molecular Formula | C24H30FN5O4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-(3-methoxy-3-methylbutyl)urea |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)NCCC(C)(C)OC)cc3)ncnc2c1 |
| InChI | InChI=1S/C24H30FN5O4/c1-24(2,33-4)9-10-26-23(31)30-17-7-5-16(6-8-17)29-22-21-19(25)13-18(34-12-11-32-3)14-20(21)27-15-28-22/h5-8,13-15H,9-12H2,1-4H3,(H2,26,30,31)(H,27,28,29) |
| InChIKey | TXNGMDZDVWFENG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|