C28H34FN5O4 — CID 171419949
3-(2-tert-butylpyrrolidin-1-yl)-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-oxopropanamide (PubChem CID 171419949) has the molecular formula C28H34FN5O4 and a molecular weight of 523.61 g/mol. Its IUPAC name is 3-(2-tert-butylpyrrolidin-1-yl)-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-oxopropanamide.
| Compound Name | 3-(2-tert-butylpyrrolidin-1-yl)-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 171419949 |
| Molecular Formula | C28H34FN5O4 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 3-(2-tert-butylpyrrolidin-1-yl)-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-3-oxopropanamide |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)CC(=O)N4CCCC4C(C)(C)C)cc3)ncnc2c1 |
| InChI | InChI=1S/C28H34FN5O4/c1-28(2,3)23-6-5-11-34(23)25(36)16-24(35)32-18-7-9-19(10-8-18)33-27-26-21(29)14-20(38-13-12-37-4)15-22(26)30-17-31-27/h7-10,14-15,17,23H,5-6,11-13,16H2,1-4H3,(H,32,35)(H,30,31,33) |
| InChIKey | QPJNIYMANPAWIC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|