C23H26F2N4O3 — CID 171420046
4-fluoro-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-4-methylpentanamide (PubChem CID 171420046) has the molecular formula C23H26F2N4O3 and a molecular weight of 444.48 g/mol. Its IUPAC name is 4-fluoro-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-4-methylpentanamide.
| Compound Name | 4-fluoro-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 171420046 |
| Molecular Formula | C23H26F2N4O3 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-fluoro-N-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-4-methylpentanamide |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)CCC(C)(C)F)cc3)ncnc2c1 |
| InChI | InChI=1S/C23H26F2N4O3/c1-23(2,25)9-8-20(30)28-15-4-6-16(7-5-15)29-22-21-18(24)12-17(32-11-10-31-3)13-19(21)26-14-27-22/h4-7,12-14H,8-11H2,1-3H3,(H,28,30)(H,26,27,29) |
| InChIKey | XAFRGOSYFTXTCE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|