C25H28FN5O5 — CID 171419828
N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]propanediamide (PubChem CID 171419828) has the molecular formula C25H28FN5O5 and a molecular weight of 497.53 g/mol. Its IUPAC name is N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]propanediamide.
| Compound Name | N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]propanediamide |
|---|---|
| PubChem CID | 171419828 |
| Molecular Formula | C25H28FN5O5 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N'-[4-[[5-fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]-N-[[(2S)-oxolan-2-yl]methyl]propanediamide |
| SMILES | COCCOc1cc(F)c2c(Nc3ccc(NC(=O)CC(=O)NC[C@@H]4CCCO4)cc3)ncnc2c1 |
| InChI | InChI=1S/C25H28FN5O5/c1-34-9-10-36-19-11-20(26)24-21(12-19)28-15-29-25(24)31-17-6-4-16(5-7-17)30-23(33)13-22(32)27-14-18-3-2-8-35-18/h4-7,11-12,15,18H,2-3,8-10,13-14H2,1H3,(H,27,32)(H,30,33)(H,28,29,31)/t18-/m0/s1 |
| InChIKey | PFFQFOBMPPDYKJ-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|