C20H24FN3O2 — CID 168926957
4-N-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenyl]-1-N-methylbenzene-1,4-diamine (PubChem CID 168926957) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-N-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenyl]-1-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenyl]-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 168926957 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-N-[1-[2-(ethylideneamino)-6-fluoro-4-(2-methoxyethoxy)phenyl]ethenyl]-1-N-methylbenzene-1,4-diamine |
| SMILES | C=C(Nc1ccc(NC)cc1)c1c(F)cc(OCCOC)cc1/N=C/C |
| InChI | InChI=1S/C20H24FN3O2/c1-5-23-19-13-17(26-11-10-25-4)12-18(21)20(19)14(2)24-16-8-6-15(22-3)7-9-16/h5-9,12-13,22,24H,2,10-11H2,1,3-4H3/b23-5+ |
| InChIKey | PBYPLRIHPXIXIJ-MUDSWDHVSA-N |
| XLogP | 4.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|