C29H44FN5O2 — CID 168927518
butane;1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenylamino]phenyl]-3-(3-methylbutyl)urea (PubChem CID 168927518) has the molecular formula C29H44FN5O2 and a molecular weight of 513.70 g/mol. Its IUPAC name is butane;1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenylamino]phenyl]-3-(3-methylbutyl)urea.
| Compound Name | butane;1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenylamino]phenyl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 168927518 |
| Molecular Formula | C29H44FN5O2 |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | butane;1-[4-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenylamino]phenyl]-3-(3-methylbutyl)urea |
| SMILES | C=C(Nc1ccc(NC(=O)NCCC(C)C)cc1)c1c(F)cc(OCCNC)cc1/N=C/C.CCCC |
| InChI | InChI=1S/C25H34FN5O2.C4H10/c1-6-28-23-16-21(33-14-13-27-5)15-22(26)24(23)18(4)30-19-7-9-20(10-8-19)31-25(32)29-12-11-17(2)3;1-3-4-2/h6-10,15-17,27,30H,4,11-14H2,1-3,5H3,(H2,29,31,32);3-4H2,1-2H3/b28-6+; |
| InChIKey | URZHOIDPWZFGSJ-FUVKFKNKSA-N |
| XLogP | 7.20 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|