C16H21Cl3N2O2 — CID 133179595
2,2,2-trichloro-N-[4-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]acetamide (PubChem CID 133179595) has the molecular formula C16H21Cl3N2O2 and a molecular weight of 379.72 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 133179595 |
| Molecular Formula | C16H21Cl3N2O2 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[2-(3-methylpiperidin-1-yl)ethoxy]phenyl]acetamide |
| SMILES | CC1CCCN(CCOc2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)C1 |
| InChI | InChI=1S/C16H21Cl3N2O2/c1-12-3-2-8-21(11-12)9-10-23-14-6-4-13(5-7-14)20-15(22)16(17,18)19/h4-7,12H,2-3,8-11H2,1H3,(H,20,22) |
| InChIKey | VGXPSCHHYXVIJR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|