C27H37N3O — CID 145071102
1-benzylpiperidine;methanamine;N-methyl-3-phenylmethoxyaniline (PubChem CID 145071102) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-benzylpiperidine;methanamine;N-methyl-3-phenylmethoxyaniline.
| Compound Name | 1-benzylpiperidine;methanamine;N-methyl-3-phenylmethoxyaniline |
|---|---|
| PubChem CID | 145071102 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 1-benzylpiperidine;methanamine;N-methyl-3-phenylmethoxyaniline |
| SMILES | CN.CNc1cccc(OCc2ccccc2)c1.c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C14H15NO.C12H17N.CH5N/c1-15-13-8-5-9-14(10-13)16-11-12-6-3-2-4-7-12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2/h2-10,15H,11H2,1H3;1,3-4,7-8H,2,5-6,9-11H2;2H2,1H3 |
| InChIKey | IGJMHGKPADNBGR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |