C21H28N4O7 — CID 138695755
2-[2-(2-aminoethoxy)ethoxy]ethyl-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamic acid (PubChem CID 138695755) has the molecular formula C21H28N4O7 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]ethyl-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamic acid.
| Compound Name | 2-[2-(2-aminoethoxy)ethoxy]ethyl-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 138695755 |
| Molecular Formula | C21H28N4O7 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]ethyl-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamic acid |
| SMILES | NCCOCCOCCN(Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C21H28N4O7/c22-5-7-31-9-10-32-8-6-24(21(29)30)12-14-1-2-16-15(11-14)13-25(20(16)28)17-3-4-18(26)23-19(17)27/h1-2,11,17H,3-10,12-13,22H2,(H,29,30)(H,23,26,27) |
| InChIKey | KWOPLGHXFCFVAS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|