C20H26N4O7 — CID 170431760
1-[2-(2-aminoethoxy)ethoxy]ethyl N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamate (PubChem CID 170431760) has the molecular formula C20H26N4O7 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-[2-(2-aminoethoxy)ethoxy]ethyl N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamate.
| Compound Name | 1-[2-(2-aminoethoxy)ethoxy]ethyl N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamate |
|---|---|
| PubChem CID | 170431760 |
| Molecular Formula | C20H26N4O7 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[2-(2-aminoethoxy)ethoxy]ethyl N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]carbamate |
| SMILES | CC(OCCOCCN)OC(=O)Nc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H26N4O7/c1-12(30-9-8-29-7-6-21)31-20(28)22-14-2-3-15-13(10-14)11-24(19(15)27)16-4-5-17(25)23-18(16)26/h2-3,10,12,16H,4-9,11,21H2,1H3,(H,22,28)(H,23,25,26) |
| InChIKey | ZTRGSQMCVYDYIC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|