C28H32N4O7 — CID 167462744
tert-butyl N-[1-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynoyl]piperidin-4-yl]carbamate (PubChem CID 167462744) has the molecular formula C28H32N4O7 and a molecular weight of 536.59 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 167462744 |
| Molecular Formula | C28H32N4O7 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | tert-butyl N-[1-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]pent-4-ynoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)CCC#Cc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C28H32N4O7/c1-28(2,3)39-27(38)29-18-13-15-31(16-14-18)22(34)10-5-4-7-17-8-6-9-19-23(17)26(37)32(25(19)36)20-11-12-21(33)30-24(20)35/h6,8-9,18,20H,5,10-16H2,1-3H3,(H,29,38)(H,30,33,35) |
| InChIKey | LRMJDFJYCCZVDG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|