C27H29N3O9 — CID 166630336
(5-hydroxy-4-oxopyran-2-yl)methyl 8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octanoate (PubChem CID 166630336) has the molecular formula C27H29N3O9 and a molecular weight of 539.54 g/mol. Its IUPAC name is (5-hydroxy-4-oxopyran-2-yl)methyl 8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octanoate.
| Compound Name | (5-hydroxy-4-oxopyran-2-yl)methyl 8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octanoate |
|---|---|
| PubChem CID | 166630336 |
| Molecular Formula | C27H29N3O9 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | (5-hydroxy-4-oxopyran-2-yl)methyl 8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]octanoate |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCCCC(=O)OCc4cc(=O)c(O)co4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H29N3O9/c31-20-13-16(38-15-21(20)32)14-39-23(34)9-4-2-1-3-5-12-28-18-8-6-7-17-24(18)27(37)30(26(17)36)19-10-11-22(33)29-25(19)35/h6-8,13,15,19,28,32H,1-5,9-12,14H2,(H,29,33,35) |
| InChIKey | WNZPMDBPOIDSBB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|