C24H24N4O5 — CID 175849835
2-(azetidin-3-ylmethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzamide (PubChem CID 175849835) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzamide.
| Compound Name | 2-(azetidin-3-ylmethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 175849835 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-(azetidin-3-ylmethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]benzamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)c4ccccc4OCC4CNC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H24N4O5/c29-21-8-7-19(23(31)27-21)28-12-15-9-16(5-6-17(15)24(28)32)26-22(30)18-3-1-2-4-20(18)33-13-14-10-25-11-14/h1-6,9,14,19,25H,7-8,10-13H2,(H,26,30)(H,27,29,31) |
| InChIKey | DTUGEPOIVPEDHV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|