C32H32N4O4 — CID 167293493
N-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]phenyl]benzamide (PubChem CID 167293493) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]phenyl]benzamide.
| Compound Name | N-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 167293493 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | N-[3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]phenyl]benzamide |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5cccc(NC(=O)c6ccccc6)c5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H32N4O4/c37-29-12-11-28(31(39)34-29)36-20-25-18-24(9-10-27(25)32(36)40)22-13-15-35(16-14-22)19-21-5-4-8-26(17-21)33-30(38)23-6-2-1-3-7-23/h1-10,17-18,22,28H,11-16,19-20H2,(H,33,38)(H,34,37,39) |
| InChIKey | RQWLWUDPFHHYGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|