C30H30FN5O3 — CID 167293554
3-[6-[1-[[3-[(5-fluoro-2-pyridinyl)amino]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167293554) has the molecular formula C30H30FN5O3 and a molecular weight of 527.60 g/mol. Its IUPAC name is 3-[6-[1-[[3-[(5-fluoro-2-pyridinyl)amino]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[[3-[(5-fluoro-2-pyridinyl)amino]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167293554 |
| Molecular Formula | C30H30FN5O3 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 3-[6-[1-[[3-[(5-fluoro-2-pyridinyl)amino]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5cccc(Nc6ccc(F)cn6)c5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H30FN5O3/c31-23-5-8-27(32-16-23)33-24-3-1-2-19(14-24)17-35-12-10-20(11-13-35)21-4-6-25-22(15-21)18-36(30(25)39)26-7-9-28(37)34-29(26)38/h1-6,8,14-16,20,26H,7,9-13,17-18H2,(H,32,33)(H,34,37,38) |
| InChIKey | WXLWQHDORLYHSL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|