C33H31N5O3 — CID 167011324
3-[3-oxo-6-[1-[(2-phenylquinazolin-7-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167011324) has the molecular formula C33H31N5O3 and a molecular weight of 545.64 g/mol. Its IUPAC name is 3-[3-oxo-6-[1-[(2-phenylquinazolin-7-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[1-[(2-phenylquinazolin-7-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167011324 |
| Molecular Formula | C33H31N5O3 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 3-[3-oxo-6-[1-[(2-phenylquinazolin-7-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5ccc6cnc(-c7ccccc7)nc6c5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H31N5O3/c39-30-11-10-29(32(40)36-30)38-20-26-17-24(8-9-27(26)33(38)41)22-12-14-37(15-13-22)19-21-6-7-25-18-34-31(35-28(25)16-21)23-4-2-1-3-5-23/h1-9,16-18,22,29H,10-15,19-20H2,(H,36,39,40) |
| InChIKey | JRTVMTZUSYGTKA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|