C33H32N4O5 — CID 163260329
3-[3-oxo-6-[1-[(3-oxo-4-phenyl-1,4-benzoxazin-6-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 163260329) has the molecular formula C33H32N4O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is 3-[3-oxo-6-[1-[(3-oxo-4-phenyl-1,4-benzoxazin-6-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[1-[(3-oxo-4-phenyl-1,4-benzoxazin-6-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163260329 |
| Molecular Formula | C33H32N4O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 3-[3-oxo-6-[1-[(3-oxo-4-phenyl-1,4-benzoxazin-6-yl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5ccc6c(c5)N(c5ccccc5)C(=O)CO6)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H32N4O5/c38-30-11-9-27(32(40)34-30)36-19-24-17-23(7-8-26(24)33(36)41)22-12-14-35(15-13-22)18-21-6-10-29-28(16-21)37(31(39)20-42-29)25-4-2-1-3-5-25/h1-8,10,16-17,22,27H,9,11-15,18-20H2,(H,34,38,40) |
| InChIKey | FLNDWPIBCGXJRF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|