C31H31N5O5S — CID 167011317
3-[3-oxo-6-[1-[[5-oxo-4-(1,2-thiazol-5-yl)-2,3-dihydro-1,4-benzoxazepin-7-yl]methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167011317) has the molecular formula C31H31N5O5S and a molecular weight of 585.69 g/mol. Its IUPAC name is 3-[3-oxo-6-[1-[[5-oxo-4-(1,2-thiazol-5-yl)-2,3-dihydro-1,4-benzoxazepin-7-yl]methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[1-[[5-oxo-4-(1,2-thiazol-5-yl)-2,3-dihydro-1,4-benzoxazepin-7-yl]methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167011317 |
| Molecular Formula | C31H31N5O5S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 3-[3-oxo-6-[1-[[5-oxo-4-(1,2-thiazol-5-yl)-2,3-dihydro-1,4-benzoxazepin-7-yl]methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(Cc5ccc6c(c5)C(=O)N(c5ccns5)CCO6)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H31N5O5S/c37-27-6-4-25(29(38)33-27)36-18-22-16-21(2-3-23(22)30(36)39)20-8-11-34(12-9-20)17-19-1-5-26-24(15-19)31(40)35(13-14-41-26)28-7-10-32-42-28/h1-3,5,7,10,15-16,20,25H,4,6,8-9,11-14,17-18H2,(H,33,37,38) |
| InChIKey | WROGEFLUUXIXHP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|