C32H35N3O3 — CID 155007511
3-[6-[1-[[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155007511) has the molecular formula C32H35N3O3 and a molecular weight of 509.65 g/mol. Its IUPAC name is 3-[6-[1-[[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155007511 |
| Molecular Formula | C32H35N3O3 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 3-[6-[1-[[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C/C=C\C=C(/C)c1ccc(CN2CCC(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C32H35N3O3/c1-3-4-5-6-22(2)24-9-7-23(8-10-24)20-34-17-15-25(16-18-34)26-11-12-28-27(19-26)21-35(32(28)38)29-13-14-30(36)33-31(29)37/h3-12,19,25,29H,1,13-18,20-21H2,2H3,(H,33,36,37)/b5-4-,22-6+ |
| InChIKey | OPJKVOIYZQEDFF-ZNFKDDGLSA-N |
| XLogP | 4.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|