C28H32N6O3 — CID 142562566
3-[6-[1-[[1-[(2E)-1-methyliminopenta-2,4-dien-2-yl]pyrazol-4-yl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 142562566) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 3-[6-[1-[[1-[(2E)-1-methyliminopenta-2,4-dien-2-yl]pyrazol-4-yl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[[1-[(2E)-1-methyliminopenta-2,4-dien-2-yl]pyrazol-4-yl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142562566 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 3-[6-[1-[[1-[(2E)-1-methyliminopenta-2,4-dien-2-yl]pyrazol-4-yl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C/C=C(\C=N\C)n1cc(CN2CCC(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cn1 |
| InChI | InChI=1S/C28H32N6O3/c1-3-4-23(15-29-2)34-17-19(14-30-34)16-32-11-9-20(10-12-32)21-5-6-24-22(13-21)18-33(28(24)37)25-7-8-26(35)31-27(25)36/h3-6,13-15,17,20,25H,1,7-12,16,18H2,2H3,(H,31,35,36)/b23-4+,29-15+ |
| InChIKey | IGBIGFNXPCDRCP-VGIDOZHYSA-N |
| XLogP | 2.75 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|