C19H20F2N4O4 — CID 167721823
5-[[3-(difluoromethyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167721823) has the molecular formula C19H20F2N4O4 and a molecular weight of 406.39 g/mol. Its IUPAC name is 5-[[3-(difluoromethyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[3-(difluoromethyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167721823 |
| Molecular Formula | C19H20F2N4O4 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 5-[[3-(difluoromethyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CCNC(C(F)F)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H20F2N4O4/c20-16(21)13-9-24(6-5-22-13)8-10-1-2-11-12(7-10)19(29)25(18(11)28)14-3-4-15(26)23-17(14)27/h1-2,7,13-14,16,22H,3-6,8-9H2,(H,23,26,27) |
| InChIKey | URJDHXBRTSEURQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|