C20H15ClIN3O4 — CID 170628981
4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-iodo-1-oxo-3H-isoindol-5-yl]benzamide (PubChem CID 170628981) has the molecular formula C20H15ClIN3O4 and a molecular weight of 523.71 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-iodo-1-oxo-3H-isoindol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-iodo-1-oxo-3H-isoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 170628981 |
| Molecular Formula | C20H15ClIN3O4 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 522.98 |
| IUPAC Name | 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-iodo-1-oxo-3H-isoindol-5-yl]benzamide |
| SMILES | O=C1CCC(N2Cc3cc(NC(=O)c4ccc(Cl)cc4)c(I)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H15ClIN3O4/c21-12-3-1-10(2-4-12)18(27)23-15-7-11-9-25(20(29)13(11)8-14(15)22)16-5-6-17(26)24-19(16)28/h1-4,7-8,16H,5-6,9H2,(H,23,27)(H,24,26,28) |
| InChIKey | BEGOPEVHKSCNRU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|