C23H19N5O4 — CID 167821897
2-(2,6-dioxopiperidin-3-yl)-N-[2-(1H-imidazol-2-yl)phenyl]-3-oxo-1H-isoindole-5-carboxamide (PubChem CID 167821897) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[2-(1H-imidazol-2-yl)phenyl]-3-oxo-1H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[2-(1H-imidazol-2-yl)phenyl]-3-oxo-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 167821897 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[2-(1H-imidazol-2-yl)phenyl]-3-oxo-1H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(C(=O)Nc4ccccc4-c4ncc[nH]4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19N5O4/c29-19-8-7-18(22(31)27-19)28-12-14-6-5-13(11-16(14)23(28)32)21(30)26-17-4-2-1-3-15(17)20-24-9-10-25-20/h1-6,9-11,18H,7-8,12H2,(H,24,25)(H,26,30)(H,27,29,31) |
| InChIKey | JEDOTVTXLOPQEI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|