C22H18ClN3O4 — CID 170628946
4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-ethenyl-1-oxo-3H-isoindol-5-yl]benzamide (PubChem CID 170628946) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-ethenyl-1-oxo-3H-isoindol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-ethenyl-1-oxo-3H-isoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 170628946 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-chloro-N-[2-(2,6-dioxopiperidin-3-yl)-6-ethenyl-1-oxo-3H-isoindol-5-yl]benzamide |
| SMILES | C=Cc1cc2c(cc1NC(=O)c1ccc(Cl)cc1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H18ClN3O4/c1-2-12-9-16-14(10-17(12)24-20(28)13-3-5-15(23)6-4-13)11-26(22(16)30)18-7-8-19(27)25-21(18)29/h2-6,9-10,18H,1,7-8,11H2,(H,24,28)(H,25,27,29) |
| InChIKey | UJTNEGDQXARUPE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|