C25H28N4O4S — CID 167230688
N-[(1R)-1-[4-[(dimethylamino)methyl]phenyl]-2-sulfanylethyl]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 167230688) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[(1R)-1-[4-[(dimethylamino)methyl]phenyl]-2-sulfanylethyl]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[(1R)-1-[4-[(dimethylamino)methyl]phenyl]-2-sulfanylethyl]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 167230688 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[(1R)-1-[4-[(dimethylamino)methyl]phenyl]-2-sulfanylethyl]-2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | CN(C)Cc1ccc([C@H](CS)NC(=O)c2ccc3c(c2)CN([C@H]2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C25H28N4O4S/c1-28(2)12-15-3-5-16(6-4-15)20(14-34)26-23(31)17-7-8-19-18(11-17)13-29(25(19)33)21-9-10-22(30)27-24(21)32/h3-8,11,20-21,34H,9-10,12-14H2,1-2H3,(H,26,31)(H,27,30,32)/t20-,21-/m0/s1 |
| InChIKey | FXMSYIZZIMIHQO-SFTDATJTSA-N |
| XLogP | 1.91 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|