C21H35N3O4S — CID 20630093
N-[4-(2,6-dimethylmorpholin-4-yl)-3-methylphenyl]-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 20630093) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-methylphenyl]-5-(propan-2-ylsulfonylamino)pentanamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-methylphenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 20630093 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-methylphenyl]-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | Cc1cc(NC(=O)CCCCNS(=O)(=O)C(C)C)ccc1N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C21H35N3O4S/c1-15(2)29(26,27)22-11-7-6-8-21(25)23-19-9-10-20(16(3)12-19)24-13-17(4)28-18(5)14-24/h9-10,12,15,17-18,22H,6-8,11,13-14H2,1-5H3,(H,23,25) |
| InChIKey | UMNFCYVKJPJSEW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|