C17H26N2O5S — CID 20629231
N-(3-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-5-(propan-2-ylsulfonylamino)pentanamide (PubChem CID 20629231) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(3-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-5-(propan-2-ylsulfonylamino)pentanamide.
| Compound Name | N-(3-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-5-(propan-2-ylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 20629231 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-(3-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-5-(propan-2-ylsulfonylamino)pentanamide |
| SMILES | CC1COc2ccc(NC(=O)CCCCNS(=O)(=O)C(C)C)cc2O1 |
| InChI | InChI=1S/C17H26N2O5S/c1-12(2)25(21,22)18-9-5-4-6-17(20)19-14-7-8-15-16(10-14)24-13(3)11-23-15/h7-8,10,12-13,18H,4-6,9,11H2,1-3H3,(H,19,20) |
| InChIKey | QQKIDJYQWPBNLX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|