C22H39N3O3S — CID 70938938
N-[5-[4-(2,6-dimethylmorpholin-4-yl)-2,6-dimethylanilino]pentyl]propane-2-sulfonamide (PubChem CID 70938938) has the molecular formula C22H39N3O3S and a molecular weight of 425.64 g/mol. Its IUPAC name is N-[5-[4-(2,6-dimethylmorpholin-4-yl)-2,6-dimethylanilino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[4-(2,6-dimethylmorpholin-4-yl)-2,6-dimethylanilino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70938938 |
| Molecular Formula | C22H39N3O3S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[5-[4-(2,6-dimethylmorpholin-4-yl)-2,6-dimethylanilino]pentyl]propane-2-sulfonamide |
| SMILES | Cc1cc(N2CC(C)OC(C)C2)cc(C)c1NCCCCCNS(=O)(=O)C(C)C |
| InChI | InChI=1S/C22H39N3O3S/c1-16(2)29(26,27)24-11-9-7-8-10-23-22-17(3)12-21(13-18(22)4)25-14-19(5)28-20(6)15-25/h12-13,16,19-20,23-24H,7-11,14-15H2,1-6H3 |
| InChIKey | MTJMRVYTIINWFX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|