C26H38ClN3O3S — CID 70939255
N-[5-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-methylanilino]pentyl]propane-2-sulfonamide (PubChem CID 70939255) has the molecular formula C26H38ClN3O3S and a molecular weight of 508.13 g/mol. Its IUPAC name is N-[5-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-methylanilino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-methylanilino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939255 |
| Molecular Formula | C26H38ClN3O3S |
| Molecular Weight | 508.13 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-[5-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-methylanilino]pentyl]propane-2-sulfonamide |
| SMILES | Cc1cc(N2CCC(O)(c3ccc(Cl)cc3)CC2)ccc1NCCCCCNS(=O)(=O)C(C)C |
| InChI | InChI=1S/C26H38ClN3O3S/c1-20(2)34(32,33)29-16-6-4-5-15-28-25-12-11-24(19-21(25)3)30-17-13-26(31,14-18-30)22-7-9-23(27)10-8-22/h7-12,19-20,28-29,31H,4-6,13-18H2,1-3H3 |
| InChIKey | UNZKWSZWHQWOPX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.13 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|