C26H35ClN4O4S — CID 20630265
N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 20630265) has the molecular formula C26H35ClN4O4S and a molecular weight of 535.11 g/mol. Its IUPAC name is N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20630265 |
| Molecular Formula | C26H35ClN4O4S |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(C)S(=O)(=O)NC1CCN(C(=O)Nc2ccc(N3CCC(O)(c4ccc(Cl)cc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H35ClN4O4S/c1-19(2)36(34,35)29-23-11-15-31(16-12-23)25(32)28-22-7-9-24(10-8-22)30-17-13-26(33,14-18-30)20-3-5-21(27)6-4-20/h3-10,19,23,29,33H,11-18H2,1-2H3,(H,28,32) |
| InChIKey | SUGQITAQRAQWMD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|