C21H33N5O4S — CID 20630279
N-[4-(4-acetylpiperazin-1-yl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 20630279) has the molecular formula C21H33N5O4S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20630279 |
| Molecular Formula | C21H33N5O4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)N3CCC(NS(=O)(=O)C(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C21H33N5O4S/c1-16(2)31(29,30)23-19-8-10-26(11-9-19)21(28)22-18-4-6-20(7-5-18)25-14-12-24(13-15-25)17(3)27/h4-7,16,19,23H,8-15H2,1-3H3,(H,22,28) |
| InChIKey | COYSYUUKPWQLKT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|