C18H20N2Na2O6S4 — CID 126960837
disodium 4-{[6-oxo-6-(4-sulfonothioatoanilino)hexanoyl]amino}benzenesulfonothioate (PubChem CID 126960837) has the molecular formula C18H20N2Na2O6S4 and a molecular weight of 534.61 g/mol.
| Compound Name | disodium 4-{[6-oxo-6-(4-sulfonothioatoanilino)hexanoyl]amino}benzenesulfonothioate |
|---|---|
| PubChem CID | 126960837 |
| Molecular Formula | C18H20N2Na2O6S4 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | — |
| SMILES | O=C(CCCCC(=O)Nc1ccc(S(=O)(O)=S)cc1)Nc1ccc(S(=O)(O)=S)cc1.[Na].[Na] |
| InChI | InChI=1S/C18H20N2O6S4.2Na/c21-17(19-13-5-9-15(10-6-13)29(23,24)27)3-1-2-4-18(22)20-14-7-11-16(12-8-14)30(25,26)28;;/h5-12H,1-4H2,(H,19,21)(H,20,22)(H,23,24,27)(H,25,26,28);; |
| InChIKey | VOGJPFOGEHZCFS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|