C22H16ClN3O4S — CID 55819813
N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide (PubChem CID 55819813) has the molecular formula C22H16ClN3O4S and a molecular weight of 453.91 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide.
| Compound Name | N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 55819813 |
| Molecular Formula | C22H16ClN3O4S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-4-(1,3-oxazol-5-yl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C22H16ClN3O4S/c23-17-8-10-18(11-9-17)26-31(28,29)20-3-1-2-19(12-20)25-22(27)16-6-4-15(5-7-16)21-13-24-14-30-21/h1-14,26H,(H,25,27) |
| InChIKey | JJJQASIPMKMYJP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |