C11H9F3N2O3S — CID 96694920
2-(cyanomethylsulfonyl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 96694920) has the molecular formula C11H9F3N2O3S and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-(cyanomethylsulfonyl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(cyanomethylsulfonyl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 96694920 |
| Molecular Formula | C11H9F3N2O3S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(cyanomethylsulfonyl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#CCS(=O)(=O)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O3S/c12-11(13,14)8-3-1-2-4-9(8)16-10(17)7-20(18,19)6-5-15/h1-4H,6-7H2,(H,16,17) |
| InChIKey | KAWAHTLGNXKSMM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |