C12H13ClN2O3S — CID 82531658
N-(2-chlorophenyl)-2-(3-cyanopropylsulfonyl)acetamide (PubChem CID 82531658) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(3-cyanopropylsulfonyl)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(3-cyanopropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 82531658 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(2-chlorophenyl)-2-(3-cyanopropylsulfonyl)acetamide |
| SMILES | N#CCCCS(=O)(=O)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN2O3S/c13-10-5-1-2-6-11(10)15-12(16)9-19(17,18)8-4-3-7-14/h1-2,5-6H,3-4,8-9H2,(H,15,16) |
| InChIKey | NUGCUTKAULOGOP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|