C23H22ClNO4 — CID 9173306
(2R)-N-(5-chloro-2-phenoxyphenyl)-2-(2-methoxyphenoxy)butanamide (PubChem CID 9173306) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-phenoxyphenyl)-2-(2-methoxyphenoxy)butanamide.
| Compound Name | (2R)-N-(5-chloro-2-phenoxyphenyl)-2-(2-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 9173306 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (2R)-N-(5-chloro-2-phenoxyphenyl)-2-(2-methoxyphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccccc1OC)C(=O)Nc1cc(Cl)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C23H22ClNO4/c1-3-19(29-22-12-8-7-11-21(22)27-2)23(26)25-18-15-16(24)13-14-20(18)28-17-9-5-4-6-10-17/h4-15,19H,3H2,1-2H3,(H,25,26)/t19-/m1/s1 |
| InChIKey | LKFYRHJDMAGZIP-LJQANCHMSA-N |
| XLogP | 5.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |