C17H17ClN2O3 — CID 2986502
N-(5-chloro-2-methoxyphenyl)-N'-(1-phenylethyl)oxamide (PubChem CID 2986502) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-N'-(1-phenylethyl)oxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 2986502 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-N'-(1-phenylethyl)oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-11(12-6-4-3-5-7-12)19-16(21)17(22)20-14-10-13(18)8-9-15(14)23-2/h3-11H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | IXYQQEDZXUMFNI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|