C18H21BrN2O4 — CID 26508863
2-(4-bromo-3-methylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 26508863) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is 2-(4-bromo-3-methylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-3-methylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26508863 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-(4-bromo-3-methylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CNc2ccc(Br)c(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21BrN2O4/c1-11-7-12(5-6-14(11)19)20-10-17(22)21-13-8-15(23-2)18(25-4)16(9-13)24-3/h5-9,20H,10H2,1-4H3,(H,21,22) |
| InChIKey | XITIBGDQZBVNRU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |