C21H30N4O2 — CID 92706705
1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea (PubChem CID 92706705) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea.
| Compound Name | 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
|---|---|
| PubChem CID | 92706705 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
| SMILES | CCN1CCC[C@@H]1CNC(=O)Nc1cn(CC(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H30N4O2/c1-4-24-11-7-8-16(24)12-22-21(27)23-19-14-25(13-15(2)3)20(26)18-10-6-5-9-17(18)19/h5-6,9-10,14-16H,4,7-8,11-13H2,1-3H3,(H2,22,23,27)/t16-/m1/s1 |
| InChIKey | LNBZKLHWMCCZDR-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |