C19H15N3O5 — CID 108816209
3-[[(Z)-3-[4-(carboxymethyl)anilino]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 108816209) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-[[(Z)-3-[4-(carboxymethyl)anilino]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-[4-(carboxymethyl)anilino]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816209 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-[[(Z)-3-[4-(carboxymethyl)anilino]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1ccc(CC(=O)O)cc1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H15N3O5/c20-10-14(11-21-15-6-4-12(5-7-15)8-17(23)24)18(25)22-16-3-1-2-13(9-16)19(26)27/h1-7,9,11,21H,8H2,(H,22,25)(H,23,24)(H,26,27)/b14-11- |
| InChIKey | CPSOWCQKKMOGJO-KAMYIIQDSA-N |
| XLogP | 2.47 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|