C24H20BrN3O — CID 108840575
(Z)-N-benzhydryl-3-[(2-bromophenyl)methylamino]-2-cyanoprop-2-enamide (PubChem CID 108840575) has the molecular formula C24H20BrN3O and a molecular weight of 446.35 g/mol. Its IUPAC name is (Z)-N-benzhydryl-3-[(2-bromophenyl)methylamino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-benzhydryl-3-[(2-bromophenyl)methylamino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108840575 |
| Molecular Formula | C24H20BrN3O |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (Z)-N-benzhydryl-3-[(2-bromophenyl)methylamino]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccccc1Br)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20BrN3O/c25-22-14-8-7-13-20(22)16-27-17-21(15-26)24(29)28-23(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-14,17,23,27H,16H2,(H,28,29)/b21-17- |
| InChIKey | RUYWOPLQWKTCBM-FXBPSFAMSA-N |
| XLogP | 4.85 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|