C17H13BrN4O2 — CID 108856948
(Z)-N-(3-acetylphenyl)-3-[(4-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide (PubChem CID 108856948) has the molecular formula C17H13BrN4O2 and a molecular weight of 385.22 g/mol. Its IUPAC name is (Z)-N-(3-acetylphenyl)-3-[(4-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(3-acetylphenyl)-3-[(4-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108856948 |
| Molecular Formula | C17H13BrN4O2 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | (Z)-N-(3-acetylphenyl)-3-[(4-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\Nc2cc(Br)ccn2)c1 |
| InChI | InChI=1S/C17H13BrN4O2/c1-11(23)12-3-2-4-15(7-12)22-17(24)13(9-19)10-21-16-8-14(18)5-6-20-16/h2-8,10H,1H3,(H,20,21)(H,22,24)/b13-10- |
| InChIKey | IMMJNMQRMMSFHO-RAXLEYEMSA-N |
| XLogP | 3.50 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|