C20H23ClN4O3 — CID 108852342
(Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide (PubChem CID 108852342) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108852342 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide |
| SMILES | CC1(C)CC2CC(C)(CN2/C=C(/C#N)C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H23ClN4O3/c1-19(2)7-15-8-20(3,11-19)12-24(15)10-13(9-22)18(26)23-14-4-5-16(21)17(6-14)25(27)28/h4-6,10,15H,7-8,11-12H2,1-3H3,(H,23,26)/b13-10- |
| InChIKey | NMSCPTCMKZDIRJ-RAXLEYEMSA-N |
| XLogP | 4.49 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|