C20H24FN3O — CID 108851974
(Z)-2-cyano-N-(4-fluorophenyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide (PubChem CID 108851974) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-fluorophenyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-fluorophenyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108851974 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (Z)-2-cyano-N-(4-fluorophenyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide |
| SMILES | CC1(C)CC2CC(C)(CN2/C=C(/C#N)C(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H24FN3O/c1-19(2)8-17-9-20(3,12-19)13-24(17)11-14(10-22)18(25)23-16-6-4-15(21)5-7-16/h4-7,11,17H,8-9,12-13H2,1-3H3,(H,23,25)/b14-11- |
| InChIKey | BINCEWPWPCBEDT-KAMYIIQDSA-N |
| XLogP | 4.07 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|