C18H29N3O — CID 108833030
(Z)-2-cyano-N-(2-methylpropyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide (PubChem CID 108833030) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-methylpropyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-methylpropyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108833030 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | (Z)-2-cyano-N-(2-methylpropyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enamide |
| SMILES | CC(C)CNC(=O)/C(C#N)=C\N1CC2(C)CC1CC(C)(C)C2 |
| InChI | InChI=1S/C18H29N3O/c1-13(2)9-20-16(22)14(8-19)10-21-12-18(5)7-15(21)6-17(3,4)11-18/h10,13,15H,6-7,9,11-12H2,1-5H3,(H,20,22)/b14-10- |
| InChIKey | IFQPQNYKLLTILA-UVTDQMKNSA-N |
| XLogP | 3.07 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|