C25H34N4O — CID 108861618
(Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enenitrile (PubChem CID 108861618) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108861618 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)prop-2-enenitrile |
| SMILES | CC1(C)CC2CC(C)(CN2/C=C(/C#N)C(=O)N2CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C25H34N4O/c1-24(2)13-22-14-25(3,18-24)19-29(22)17-21(15-26)23(30)28-11-9-27(10-12-28)16-20-7-5-4-6-8-20/h4-8,17,22H,9-14,16,18-19H2,1-3H3/b21-17- |
| InChIKey | IMJJNIRJNIDZLM-FXBPSFAMSA-N |
| XLogP | 3.64 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|